1,2,4,5-Benzenetetracarboxylic acid tetramethyl - Names and Identifiers
Name | Tetramethyl 1,2,4,5-Benzenetetracarboxylate
|
Synonyms | Tetramethyl pyromellitate Pyromellitic acid tetramethyl Pyromellitic acid tetramethyl ester 1,2,4,5-Tetramethoxycarbonylbenzene 1,2,4,5-Tetra(methoxycarbonyl)benzene Tetramethyl 1,2,4,5-Benzenetetracarboxylate tetramethyl benzene-1,2,4,5-tetracarboxylate 1,2,4,5-Benzenetetracarboxylic acid tetramethyl 1,2,4,5-BENZENETETRACARBOXYLIC ACID, TETRAMETHYLESTER Pyromellitic acid tetramethyl ester~Tetramethyl benzene-1,2,4,5-tetracarboxylate
|
CAS | 635-10-9
|
EINECS | 211-226-6 |
InChI | InChI=1/C14H14O8/c1-19-11(15)7-5-9(13(17)21-3)10(14(18)22-4)6-8(7)12(16)20-2/h5-6H,1-4H3 |
1,2,4,5-Benzenetetracarboxylic acid tetramethyl - Physico-chemical Properties
Molecular Formula | C14H14O8
|
Molar Mass | 310.26 |
Density | 1.4258 (rough estimate) |
Melting Point | 143-144°C |
Boling Point | 410.43°C (rough estimate) |
Flash Point | 161.5°C |
Vapor Presure | 1.07E-05mmHg at 25°C |
Merck | 14,8004 |
BRN | 2226326 |
Storage Condition | Room Temprature |
Refractive Index | 1.5500 (estimate) |
MDL | MFCD00014903 |
1,2,4,5-Benzenetetracarboxylic acid tetramethyl - Risk and Safety
Safety Description | S22 - Do not breathe dust.
S24/25 - Avoid contact with skin and eyes.
|
1,2,4,5-Benzenetetracarboxylic acid tetramethyl - Introduction
Tetramethyl 1,2,4,5-Benzenetetracarboxylate(Tetramethyl 1,2,4,5-Benzenetetracarboxylate) is an organic compound with the formula C20H20O8. The following is a description of the properties, uses, preparation and safety information of the compound:
Nature:
1. Appearance: Tetramethyl 1,2,4,5-Benzenetetracarboxylate is a colorless to light yellow liquid.
2. melting point: its melting point is about 60-61 ℃.
3. Boiling point: Its boiling point is about 300 ℃.
4. density: its density is 1.2g/cm³.
5. Solubility: It is soluble in common organic solvents.
Use:
1. Chemical synthesis: Tetramethyl 1,2,4,5-Benzenetetracarboxylate can be used as raw materials or intermediates in organic synthesis. It can be used to synthesize some specific polyester, fluorescent dyes, catalysts and other compounds.
2. Cosmetics: Because Tetramethyl 1,2,4,5-Benzenetetracarboxylate has excellent light stability and antioxidant properties, it is also used in some cosmetics, such as sunscreen lotions, skin creams, etc.
Preparation Method:
The preparation method of Tetramethyl 1,2,4,5-Benzenetetracarboxylate is mainly obtained by the reaction of benzocyclopropane -1,2,4,5-tetracarboxylic acid dianhydride and methanol. Specifically, benzocyclopropane-1, 2,4, 5-tetracarboxylic dianhydride is reacted with an excess of methanol in the presence of a catalyst, such as an acid catalyst, to ultimately produce the Tetramethyl 1,2, 4,5-benzenetetratracarboxylate.
Safety Information:
1. Tetramethyl 1,2,4,5-Benzenetetracarboxylate generally does not cause significant danger under normal conditions of use.
2. however, it can cause eye and skin irritation, need to pay attention to avoid contact.
3. Wear appropriate personal protective equipment such as gloves, goggles and lab coats during operation.
4. Please pay attention to the correct storage and handling of the compound, avoid mixing with other chemicals.
5. When using Tetramethyl 1,2,4,5-Benzenetetracarboxylate, you should follow the safety operating procedures and operate in a well-ventilated place.
Last Update:2024-04-09 20:13:35